C20H35FN4O2Sn — CID 143143143
ethane;5-[[ethyl-(propan-2-yldiazenyl)amino]methyl]-3-(3-fluoro-4-trimethylstannylphenyl)-1,3-oxazolidin-2-one (PubChem CID 143143143) has the molecular formula C20H35FN4O2Sn and a molecular weight of 501.24 g/mol. Its IUPAC name is ethane;5-[[ethyl-(propan-2-yldiazenyl)amino]methyl]-3-(3-fluoro-4-trimethylstannylphenyl)-1,3-oxazolidin-2-one.
| Compound Name | ethane;5-[[ethyl-(propan-2-yldiazenyl)amino]methyl]-3-(3-fluoro-4-trimethylstannylphenyl)-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 143143143 |
| Molecular Formula | C20H35FN4O2Sn |
| Molecular Weight | 501.24 g/mol |
| Exact Mass | 502.18 |
| IUPAC Name | ethane;5-[[ethyl-(propan-2-yldiazenyl)amino]methyl]-3-(3-fluoro-4-trimethylstannylphenyl)-1,3-oxazolidin-2-one |
| SMILES | CC.CCN(CC1CN(c2ccc([Sn](C)(C)C)c(F)c2)C(=O)O1)/N=N/C(C)C |
| InChI | InChI=1S/C15H20FN4O2.C2H6.3CH3.Sn/c1-4-19(18-17-11(2)3)9-14-10-20(15(21)22-14)13-7-5-6-12(16)8-13;1-2;;;;/h5,7-8,11,14H,4,9-10H2,1-3H3;1-2H3;3*1H3;/b18-17+;;;;; |
| InChIKey | CNFCFOZYQCZXAY-SOIHCWMDSA-N |
| XLogP | 4.82 |
| TPSA | 57.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.24 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|