C20H23FN4O3S — CID 135351769
1-(dimethylamino)-1-[[(5S)-3-[3-fluoro-4-(4-methylsulfanylphenyl)phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]urea (PubChem CID 135351769) has the molecular formula C20H23FN4O3S and a molecular weight of 418.49 g/mol. Its IUPAC name is 1-(dimethylamino)-1-[[(5S)-3-[3-fluoro-4-(4-methylsulfanylphenyl)phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]urea.
| Compound Name | 1-(dimethylamino)-1-[[(5S)-3-[3-fluoro-4-(4-methylsulfanylphenyl)phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]urea |
|---|---|
| PubChem CID | 135351769 |
| Molecular Formula | C20H23FN4O3S |
| Molecular Weight | 418.49 g/mol |
| Exact Mass | 418.15 |
| IUPAC Name | 1-(dimethylamino)-1-[[(5S)-3-[3-fluoro-4-(4-methylsulfanylphenyl)phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]urea |
| SMILES | CSc1ccc(-c2ccc(N3C[C@@H](CN(C(N)=O)N(C)C)OC3=O)cc2F)cc1 |
| InChI | InChI=1S/C20H23FN4O3S/c1-23(2)25(19(22)26)12-15-11-24(20(27)28-15)14-6-9-17(18(21)10-14)13-4-7-16(29-3)8-5-13/h4-10,15H,11-12H2,1-3H3,(H2,22,26)/t15-/m0/s1 |
| InChIKey | BRJXUGQVJWUSDZ-HNNXBMFYSA-N |
| XLogP | 3.40 |
| TPSA | 79.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.49 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|