C19H19FN4O2S — CID 145300114
N-(aminomethylidene)-N'-[[3-[3-fluoro-4-(4-methylsulfanylphenyl)phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]methanimidamide (PubChem CID 145300114) has the molecular formula C19H19FN4O2S and a molecular weight of 386.45 g/mol. Its IUPAC name is N-(aminomethylidene)-N'-[[3-[3-fluoro-4-(4-methylsulfanylphenyl)phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]methanimidamide.
| Compound Name | N-(aminomethylidene)-N'-[[3-[3-fluoro-4-(4-methylsulfanylphenyl)phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]methanimidamide |
|---|---|
| PubChem CID | 145300114 |
| Molecular Formula | C19H19FN4O2S |
| Molecular Weight | 386.45 g/mol |
| Exact Mass | 386.12 |
| IUPAC Name | N-(aminomethylidene)-N'-[[3-[3-fluoro-4-(4-methylsulfanylphenyl)phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]methanimidamide |
| SMILES | CSc1ccc(-c2ccc(N3CC(C/N=C/N=C/N)OC3=O)cc2F)cc1 |
| InChI | InChI=1S/C19H19FN4O2S/c1-27-16-5-2-13(3-6-16)17-7-4-14(8-18(17)20)24-10-15(26-19(24)25)9-22-12-23-11-21/h2-8,11-12,15H,9-10H2,1H3,(H2,21,22,23) |
| InChIKey | XCFMYPLTTIDTOY-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 80.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.45 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|