C18H20F2N4O3S — CID 142436836
fluoromethane;N'-[[3-[3-fluoro-4-(3-sulfinamoylphenyl)phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]methanimidamide (PubChem CID 142436836) has the molecular formula C18H20F2N4O3S and a molecular weight of 410.45 g/mol. Its IUPAC name is fluoromethane;N'-[[3-[3-fluoro-4-(3-sulfinamoylphenyl)phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]methanimidamide.
| Compound Name | fluoromethane;N'-[[3-[3-fluoro-4-(3-sulfinamoylphenyl)phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]methanimidamide |
|---|---|
| PubChem CID | 142436836 |
| Molecular Formula | C18H20F2N4O3S |
| Molecular Weight | 410.45 g/mol |
| Exact Mass | 410.12 |
| IUPAC Name | fluoromethane;N'-[[3-[3-fluoro-4-(3-sulfinamoylphenyl)phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]methanimidamide |
| SMILES | CF.N/C=N/CC1CN(c2ccc(-c3cccc(S(N)=O)c3)c(F)c2)C(=O)O1 |
| InChI | InChI=1S/C17H17FN4O3S.CH3F/c18-16-7-12(22-9-13(8-21-10-19)25-17(22)23)4-5-15(16)11-2-1-3-14(6-11)26(20)24;1-2/h1-7,10,13H,8-9,20H2,(H2,19,21);1H3 |
| InChIKey | IWWJELDAEJQCRA-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 111.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.45 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|