C25H38BrFN2O3Si — CID 20788891
(5R)-3-[4-[(1R,5S)-6-(bromomethyl)-3-azabicyclo[3.1.0]hexan-3-yl]-3-fluorophenyl]-5-[tri(propan-2-yl)silyloxymethyl]-1,3-oxazolidin-2-one (PubChem CID 20788891) has the molecular formula C25H38BrFN2O3Si and a molecular weight of 541.58 g/mol. Its IUPAC name is (5R)-3-[4-[(1R,5S)-6-(bromomethyl)-3-azabicyclo[3.1.0]hexan-3-yl]-3-fluorophenyl]-5-[tri(propan-2-yl)silyloxymethyl]-1,3-oxazolidin-2-one.
| Compound Name | (5R)-3-[4-[(1R,5S)-6-(bromomethyl)-3-azabicyclo[3.1.0]hexan-3-yl]-3-fluorophenyl]-5-[tri(propan-2-yl)silyloxymethyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 20788891 |
| Molecular Formula | C25H38BrFN2O3Si |
| Molecular Weight | 541.58 g/mol |
| Exact Mass | 540.18 |
| IUPAC Name | (5R)-3-[4-[(1R,5S)-6-(bromomethyl)-3-azabicyclo[3.1.0]hexan-3-yl]-3-fluorophenyl]-5-[tri(propan-2-yl)silyloxymethyl]-1,3-oxazolidin-2-one |
| SMILES | CC(C)[Si](OC[C@H]1CN(c2ccc(N3C[C@@H]4C(CBr)[C@@H]4C3)c(F)c2)C(=O)O1)(C(C)C)C(C)C |
| InChI | InChI=1S/C25H38BrFN2O3Si/c1-15(2)33(16(3)4,17(5)6)31-14-19-11-29(25(30)32-19)18-7-8-24(23(27)9-18)28-12-21-20(10-26)22(21)13-28/h7-9,15-17,19-22H,10-14H2,1-6H3/t19-,20?,21-,22+/m1/s1 |
| InChIKey | NIEIRMBIVGKCDF-XCSKNGGISA-N |
| XLogP | 6.42 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.58 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|