C23H26F3N7O4 — CID 143785336
(3-fluorophenyl) 5-[4-[(5R)-5-[[amino-[(Z)-2-aminoethenyl]amino]methyl]-2-oxo-1,3-oxazolidin-3-yl]-2,6-difluorophenyl]-1,2,5-triazepane-1-carboxylate (PubChem CID 143785336) has the molecular formula C23H26F3N7O4 and a molecular weight of 521.50 g/mol. Its IUPAC name is (3-fluorophenyl) 5-[4-[(5R)-5-[[amino-[(Z)-2-aminoethenyl]amino]methyl]-2-oxo-1,3-oxazolidin-3-yl]-2,6-difluorophenyl]-1,2,5-triazepane-1-carboxylate.
| Compound Name | (3-fluorophenyl) 5-[4-[(5R)-5-[[amino-[(Z)-2-aminoethenyl]amino]methyl]-2-oxo-1,3-oxazolidin-3-yl]-2,6-difluorophenyl]-1,2,5-triazepane-1-carboxylate |
|---|---|
| PubChem CID | 143785336 |
| Molecular Formula | C23H26F3N7O4 |
| Molecular Weight | 521.50 g/mol |
| Exact Mass | 521.20 |
| IUPAC Name | (3-fluorophenyl) 5-[4-[(5R)-5-[[amino-[(Z)-2-aminoethenyl]amino]methyl]-2-oxo-1,3-oxazolidin-3-yl]-2,6-difluorophenyl]-1,2,5-triazepane-1-carboxylate |
| SMILES | N/C=C\N(N)C[C@H]1CN(c2cc(F)c(N3CCNN(C(=O)Oc4cccc(F)c4)CC3)c(F)c2)C(=O)O1 |
| InChI | InChI=1S/C23H26F3N7O4/c24-15-2-1-3-17(10-15)36-23(35)33-9-8-30(7-5-29-33)21-19(25)11-16(12-20(21)26)32-14-18(37-22(32)34)13-31(28)6-4-27/h1-4,6,10-12,18,29H,5,7-9,13-14,27-28H2/b6-4-/t18-/m0/s1 |
| InChIKey | UPHGIDTWNAASTI-SUZKBHRPSA-N |
| XLogP | 1.86 |
| TPSA | 129.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.50 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|