C22H25FN6O2 — CID 142879280
4-[4-[5-[[amino-[(Z)-2-amino-4-(methylamino)but-1-enyl]amino]methyl]-2-oxo-1,3-oxazolidin-3-yl]-2-fluorophenyl]benzonitrile (PubChem CID 142879280) has the molecular formula C22H25FN6O2 and a molecular weight of 424.48 g/mol. Its IUPAC name is 4-[4-[5-[[amino-[(Z)-2-amino-4-(methylamino)but-1-enyl]amino]methyl]-2-oxo-1,3-oxazolidin-3-yl]-2-fluorophenyl]benzonitrile.
| Compound Name | 4-[4-[5-[[amino-[(Z)-2-amino-4-(methylamino)but-1-enyl]amino]methyl]-2-oxo-1,3-oxazolidin-3-yl]-2-fluorophenyl]benzonitrile |
|---|---|
| PubChem CID | 142879280 |
| Molecular Formula | C22H25FN6O2 |
| Molecular Weight | 424.48 g/mol |
| Exact Mass | 424.20 |
| IUPAC Name | 4-[4-[5-[[amino-[(Z)-2-amino-4-(methylamino)but-1-enyl]amino]methyl]-2-oxo-1,3-oxazolidin-3-yl]-2-fluorophenyl]benzonitrile |
| SMILES | CNCC/C(N)=C/N(N)CC1CN(c2ccc(-c3ccc(C#N)cc3)c(F)c2)C(=O)O1 |
| InChI | InChI=1S/C22H25FN6O2/c1-27-9-8-17(25)12-28(26)13-19-14-29(22(30)31-19)18-6-7-20(21(23)10-18)16-4-2-15(11-24)3-5-16/h2-7,10,12,19,27H,8-9,13-14,25-26H2,1H3/b17-12- |
| InChIKey | NAKMBAAVFAXEFZ-ATVHPVEESA-N |
| XLogP | 2.27 |
| TPSA | 120.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.48 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|