C15H18FN3O4S — CID 87931203
N-[[3-(3-fluoro-4-morpholin-4-ylphenyl)-2-oxo-1,3-oxazolidin-5-yl]methyl]-N-sulfanylformamide (PubChem CID 87931203) has the molecular formula C15H18FN3O4S and a molecular weight of 355.39 g/mol. Its IUPAC name is N-[[3-(3-fluoro-4-morpholin-4-ylphenyl)-2-oxo-1,3-oxazolidin-5-yl]methyl]-N-sulfanylformamide.
| Compound Name | N-[[3-(3-fluoro-4-morpholin-4-ylphenyl)-2-oxo-1,3-oxazolidin-5-yl]methyl]-N-sulfanylformamide |
|---|---|
| PubChem CID | 87931203 |
| Molecular Formula | C15H18FN3O4S |
| Molecular Weight | 355.39 g/mol |
| Exact Mass | 355.10 |
| IUPAC Name | N-[[3-(3-fluoro-4-morpholin-4-ylphenyl)-2-oxo-1,3-oxazolidin-5-yl]methyl]-N-sulfanylformamide |
| SMILES | O=CN(S)CC1CN(c2ccc(N3CCOCC3)c(F)c2)C(=O)O1 |
| InChI | InChI=1S/C15H18FN3O4S/c16-13-7-11(1-2-14(13)17-3-5-22-6-4-17)19-9-12(23-15(19)21)8-18(24)10-20/h1-2,7,10,12,24H,3-6,8-9H2 |
| InChIKey | YZCOARYGULGYDH-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 62.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.39 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|