C21H21ClFN3O3 — CID 24759013
(5S)-5-[[(4-chlorophenyl)methylideneamino]methyl]-3-(3-fluoro-4-morpholin-4-ylphenyl)-1,3-oxazolidin-2-one (PubChem CID 24759013) has the molecular formula C21H21ClFN3O3 and a molecular weight of 417.87 g/mol. Its IUPAC name is (5S)-5-[[(4-chlorophenyl)methylideneamino]methyl]-3-(3-fluoro-4-morpholin-4-ylphenyl)-1,3-oxazolidin-2-one.
| Compound Name | (5S)-5-[[(4-chlorophenyl)methylideneamino]methyl]-3-(3-fluoro-4-morpholin-4-ylphenyl)-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 24759013 |
| Molecular Formula | C21H21ClFN3O3 |
| Molecular Weight | 417.87 g/mol |
| Exact Mass | 417.13 |
| IUPAC Name | (5S)-5-[[(4-chlorophenyl)methylideneamino]methyl]-3-(3-fluoro-4-morpholin-4-ylphenyl)-1,3-oxazolidin-2-one |
| SMILES | O=C1O[C@@H](C/N=C/c2ccc(Cl)cc2)CN1c1ccc(N2CCOCC2)c(F)c1 |
| InChI | InChI=1S/C21H21ClFN3O3/c22-16-3-1-15(2-4-16)12-24-13-18-14-26(21(27)29-18)17-5-6-20(19(23)11-17)25-7-9-28-10-8-25/h1-6,11-12,18H,7-10,13-14H2/b24-12+/t18-/m0/s1 |
| InChIKey | OMPURGCNIGTEBA-AMAFCZHPSA-N |
| XLogP | 3.76 |
| TPSA | 54.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.87 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|