C18H23FN6O3 — CID 20691454
3-cyano-2-[[3-(3-fluoro-4-morpholin-4-ylphenyl)-2-oxo-1,3-oxazolidin-5-yl]methyl]-1,1-dimethylguanidine (PubChem CID 20691454) has the molecular formula C18H23FN6O3 and a molecular weight of 390.42 g/mol. Its IUPAC name is 3-cyano-2-[[3-(3-fluoro-4-morpholin-4-ylphenyl)-2-oxo-1,3-oxazolidin-5-yl]methyl]-1,1-dimethylguanidine.
| Compound Name | 3-cyano-2-[[3-(3-fluoro-4-morpholin-4-ylphenyl)-2-oxo-1,3-oxazolidin-5-yl]methyl]-1,1-dimethylguanidine |
|---|---|
| PubChem CID | 20691454 |
| Molecular Formula | C18H23FN6O3 |
| Molecular Weight | 390.42 g/mol |
| Exact Mass | 390.18 |
| IUPAC Name | 3-cyano-2-[[3-(3-fluoro-4-morpholin-4-ylphenyl)-2-oxo-1,3-oxazolidin-5-yl]methyl]-1,1-dimethylguanidine |
| SMILES | CN(C)/C(=N\CC1CN(c2ccc(N3CCOCC3)c(F)c2)C(=O)O1)NC#N |
| InChI | InChI=1S/C18H23FN6O3/c1-23(2)17(22-12-20)21-10-14-11-25(18(26)28-14)13-3-4-16(15(19)9-13)24-5-7-27-8-6-24/h3-4,9,14H,5-8,10-11H2,1-2H3,(H,21,22) |
| InChIKey | QNBBYUBSLUYFSD-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 93.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.42 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|