C20H24FN3O4 — CID 123994016
(5S)-5-[(3-ethylidene-2-oxopyrrolidin-1-yl)methyl]-3-(3-fluoro-4-morpholin-4-ylphenyl)-1,3-oxazolidin-2-one (PubChem CID 123994016) has the molecular formula C20H24FN3O4 and a molecular weight of 389.43 g/mol. Its IUPAC name is (5S)-5-[(3-ethylidene-2-oxopyrrolidin-1-yl)methyl]-3-(3-fluoro-4-morpholin-4-ylphenyl)-1,3-oxazolidin-2-one.
| Compound Name | (5S)-5-[(3-ethylidene-2-oxopyrrolidin-1-yl)methyl]-3-(3-fluoro-4-morpholin-4-ylphenyl)-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 123994016 |
| Molecular Formula | C20H24FN3O4 |
| Molecular Weight | 389.43 g/mol |
| Exact Mass | 389.18 |
| IUPAC Name | (5S)-5-[(3-ethylidene-2-oxopyrrolidin-1-yl)methyl]-3-(3-fluoro-4-morpholin-4-ylphenyl)-1,3-oxazolidin-2-one |
| SMILES | CC=C1CCN(C[C@H]2CN(c3ccc(N4CCOCC4)c(F)c3)C(=O)O2)C1=O |
| InChI | InChI=1S/C20H24FN3O4/c1-2-14-5-6-23(19(14)25)12-16-13-24(20(26)28-16)15-3-4-18(17(21)11-15)22-7-9-27-10-8-22/h2-4,11,16H,5-10,12-13H2,1H3/t16-/m0/s1 |
| InChIKey | DCOGNEIEYYBBCW-INIZCTEOSA-N |
| XLogP | 2.17 |
| TPSA | 62.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.43 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|