C16H18FN3O5 — CID 126483798
[3-[3-fluoro-4-(2-oxa-6-azaspiro[3.3]heptan-6-yl)phenyl]-2-oxo-1,3-oxazolidin-5-yl]methylcarbamic acid (PubChem CID 126483798) has the molecular formula C16H18FN3O5 and a molecular weight of 351.33 g/mol. Its IUPAC name is [3-[3-fluoro-4-(2-oxa-6-azaspiro[3.3]heptan-6-yl)phenyl]-2-oxo-1,3-oxazolidin-5-yl]methylcarbamic acid.
| Compound Name | [3-[3-fluoro-4-(2-oxa-6-azaspiro[3.3]heptan-6-yl)phenyl]-2-oxo-1,3-oxazolidin-5-yl]methylcarbamic acid |
|---|---|
| PubChem CID | 126483798 |
| Molecular Formula | C16H18FN3O5 |
| Molecular Weight | 351.33 g/mol |
| Exact Mass | 351.12 |
| IUPAC Name | [3-[3-fluoro-4-(2-oxa-6-azaspiro[3.3]heptan-6-yl)phenyl]-2-oxo-1,3-oxazolidin-5-yl]methylcarbamic acid |
| SMILES | O=C(O)NCC1CN(c2ccc(N3CC4(COC4)C3)c(F)c2)C(=O)O1 |
| InChI | InChI=1S/C16H18FN3O5/c17-12-3-10(20-5-11(25-15(20)23)4-18-14(21)22)1-2-13(12)19-6-16(7-19)8-24-9-16/h1-3,11,18H,4-9H2,(H,21,22) |
| InChIKey | MDAUGMZUEQFNCY-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 91.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.33 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|