C19H21FN4O6 — CID 155319483
[(5S)-3-[4-[(3aR,6aS)-6a-cyclopropyl-2-oxo-3,3a,4,6-tetrahydropyrrolo[3,4-d][1,3]oxazol-5-yl]-3-fluorophenyl]-2-oxo-1,3-oxazolidin-5-yl]methylcarbamic acid (PubChem CID 155319483) has the molecular formula C19H21FN4O6 and a molecular weight of 420.40 g/mol. Its IUPAC name is [(5S)-3-[4-[(3aR,6aS)-6a-cyclopropyl-2-oxo-3,3a,4,6-tetrahydropyrrolo[3,4-d][1,3]oxazol-5-yl]-3-fluorophenyl]-2-oxo-1,3-oxazolidin-5-yl]methylcarbamic acid.
| Compound Name | [(5S)-3-[4-[(3aR,6aS)-6a-cyclopropyl-2-oxo-3,3a,4,6-tetrahydropyrrolo[3,4-d][1,3]oxazol-5-yl]-3-fluorophenyl]-2-oxo-1,3-oxazolidin-5-yl]methylcarbamic acid |
|---|---|
| PubChem CID | 155319483 |
| Molecular Formula | C19H21FN4O6 |
| Molecular Weight | 420.40 g/mol |
| Exact Mass | 420.14 |
| IUPAC Name | [(5S)-3-[4-[(3aR,6aS)-6a-cyclopropyl-2-oxo-3,3a,4,6-tetrahydropyrrolo[3,4-d][1,3]oxazol-5-yl]-3-fluorophenyl]-2-oxo-1,3-oxazolidin-5-yl]methylcarbamic acid |
| SMILES | O=C(O)NC[C@H]1CN(c2ccc(N3C[C@H]4NC(=O)O[C@@]4(C4CC4)C3)c(F)c2)C(=O)O1 |
| InChI | InChI=1S/C19H21FN4O6/c20-13-5-11(24-7-12(29-18(24)28)6-21-16(25)26)3-4-14(13)23-8-15-19(9-23,10-1-2-10)30-17(27)22-15/h3-5,10,12,15,21H,1-2,6-9H2,(H,22,27)(H,25,26)/t12-,15+,19+/m0/s1 |
| InChIKey | PFRYKPMTVJGEJW-IOHHAYIISA-N |
| XLogP | 1.50 |
| TPSA | 120.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.40 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|