C23H22FN5O3S — CID 134144709
1-(4-cyanophenyl)-3-[[(5S)-3-[3-fluoro-4-(2-oxa-6-azaspiro[3.3]heptan-6-yl)phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]thiourea (PubChem CID 134144709) has the molecular formula C23H22FN5O3S and a molecular weight of 467.53 g/mol. Its IUPAC name is 1-(4-cyanophenyl)-3-[[(5S)-3-[3-fluoro-4-(2-oxa-6-azaspiro[3.3]heptan-6-yl)phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]thiourea.
| Compound Name | 1-(4-cyanophenyl)-3-[[(5S)-3-[3-fluoro-4-(2-oxa-6-azaspiro[3.3]heptan-6-yl)phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]thiourea |
|---|---|
| PubChem CID | 134144709 |
| Molecular Formula | C23H22FN5O3S |
| Molecular Weight | 467.53 g/mol |
| Exact Mass | 467.14 |
| IUPAC Name | 1-(4-cyanophenyl)-3-[[(5S)-3-[3-fluoro-4-(2-oxa-6-azaspiro[3.3]heptan-6-yl)phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]thiourea |
| SMILES | N#Cc1ccc(NC(=S)NC[C@H]2CN(c3ccc(N4CC5(COC5)C4)c(F)c3)C(=O)O2)cc1 |
| InChI | InChI=1S/C23H22FN5O3S/c24-19-7-17(5-6-20(19)28-11-23(12-28)13-31-14-23)29-10-18(32-22(29)30)9-26-21(33)27-16-3-1-15(8-25)2-4-16/h1-7,18H,9-14H2,(H2,26,27,33)/t18-/m0/s1 |
| InChIKey | HPBOFOCERKKJRX-SFHVURJKSA-N |
| XLogP | 2.85 |
| TPSA | 89.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.53 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|