C18H22FN5O2 — CID 91502826
(5R)-3-[3-fluoro-4-[4-(isocyanomethylidene)-3-methylpiperidin-1-yl]phenyl]-5-(hydrazinylmethyl)-1,3-oxazolidin-2-one (PubChem CID 91502826) has the molecular formula C18H22FN5O2 and a molecular weight of 359.41 g/mol. Its IUPAC name is (5R)-3-[3-fluoro-4-[4-(isocyanomethylidene)-3-methylpiperidin-1-yl]phenyl]-5-(hydrazinylmethyl)-1,3-oxazolidin-2-one.
| Compound Name | (5R)-3-[3-fluoro-4-[4-(isocyanomethylidene)-3-methylpiperidin-1-yl]phenyl]-5-(hydrazinylmethyl)-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 91502826 |
| Molecular Formula | C18H22FN5O2 |
| Molecular Weight | 359.41 g/mol |
| Exact Mass | 359.18 |
| IUPAC Name | (5R)-3-[3-fluoro-4-[4-(isocyanomethylidene)-3-methylpiperidin-1-yl]phenyl]-5-(hydrazinylmethyl)-1,3-oxazolidin-2-one |
| SMILES | [C-]#[N+]C=C1CCN(c2ccc(N3C[C@H](CNN)OC3=O)cc2F)CC1C |
| InChI | InChI=1S/C18H22FN5O2/c1-12-10-23(6-5-13(12)8-21-2)17-4-3-14(7-16(17)19)24-11-15(9-22-20)26-18(24)25/h3-4,7-8,12,15,22H,5-6,9-11,20H2,1H3/t12?,15-/m0/s1 |
| InChIKey | OLKABRXXNGLGHR-CVRLYYSRSA-N |
| XLogP | 2.26 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.41 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|