C23H24F4N4O2S — CID 142669232
N-[[(5S)-3-[3-fluoro-4-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]ethanethioamide (PubChem CID 142669232) has the molecular formula C23H24F4N4O2S and a molecular weight of 496.53 g/mol. Its IUPAC name is N-[[(5S)-3-[3-fluoro-4-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]ethanethioamide.
| Compound Name | N-[[(5S)-3-[3-fluoro-4-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]ethanethioamide |
|---|---|
| PubChem CID | 142669232 |
| Molecular Formula | C23H24F4N4O2S |
| Molecular Weight | 496.53 g/mol |
| Exact Mass | 496.16 |
| IUPAC Name | N-[[(5S)-3-[3-fluoro-4-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]ethanethioamide |
| SMILES | CC(=S)NC[C@H]1CN(c2ccc(N3CCN(c4cccc(C(F)(F)F)c4)CC3)c(F)c2)C(=O)O1 |
| InChI | InChI=1S/C23H24F4N4O2S/c1-15(34)28-13-19-14-31(22(32)33-19)18-5-6-21(20(24)12-18)30-9-7-29(8-10-30)17-4-2-3-16(11-17)23(25,26)27/h2-6,11-12,19H,7-10,13-14H2,1H3,(H,28,34)/t19-/m0/s1 |
| InChIKey | PKBDEVNXLYXJER-IBGZPJMESA-N |
| XLogP | 4.43 |
| TPSA | 48.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.53 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|