C15H17FN4O3S — CID 58781031
N-[[(5S)-3-[3-fluoro-4-(4-oxoimidazolidin-1-yl)phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]ethanethioamide (PubChem CID 58781031) has the molecular formula C15H17FN4O3S and a molecular weight of 352.39 g/mol. Its IUPAC name is N-[[(5S)-3-[3-fluoro-4-(4-oxoimidazolidin-1-yl)phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]ethanethioamide.
| Compound Name | N-[[(5S)-3-[3-fluoro-4-(4-oxoimidazolidin-1-yl)phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]ethanethioamide |
|---|---|
| PubChem CID | 58781031 |
| Molecular Formula | C15H17FN4O3S |
| Molecular Weight | 352.39 g/mol |
| Exact Mass | 352.10 |
| IUPAC Name | N-[[(5S)-3-[3-fluoro-4-(4-oxoimidazolidin-1-yl)phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]ethanethioamide |
| SMILES | CC(=S)NC[C@H]1CN(c2ccc(N3CNC(=O)C3)c(F)c2)C(=O)O1 |
| InChI | InChI=1S/C15H17FN4O3S/c1-9(24)17-5-11-6-20(15(22)23-11)10-2-3-13(12(16)4-10)19-7-14(21)18-8-19/h2-4,11H,5-8H2,1H3,(H,17,24)(H,18,21)/t11-/m0/s1 |
| InChIKey | FINCWTNIKMRIKX-NSHDSACASA-N |
| XLogP | 0.98 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.39 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|