C25H23FN4O6 — CID 143554941
N-[[(5S)-3-[3-fluoro-4-[[7-hydroxy-3-(4-nitrophenyl)cyclohepta-1,3,5-trien-1-yl]amino]phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]acetamide (PubChem CID 143554941) has the molecular formula C25H23FN4O6 and a molecular weight of 494.48 g/mol. Its IUPAC name is N-[[(5S)-3-[3-fluoro-4-[[7-hydroxy-3-(4-nitrophenyl)cyclohepta-1,3,5-trien-1-yl]amino]phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]acetamide.
| Compound Name | N-[[(5S)-3-[3-fluoro-4-[[7-hydroxy-3-(4-nitrophenyl)cyclohepta-1,3,5-trien-1-yl]amino]phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]acetamide |
|---|---|
| PubChem CID | 143554941 |
| Molecular Formula | C25H23FN4O6 |
| Molecular Weight | 494.48 g/mol |
| Exact Mass | 494.16 |
| IUPAC Name | N-[[(5S)-3-[3-fluoro-4-[[7-hydroxy-3-(4-nitrophenyl)cyclohepta-1,3,5-trien-1-yl]amino]phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]acetamide |
| SMILES | CC(=O)NC[C@H]1CN(c2ccc(NC3=CC(c4ccc([N+](=O)[O-])cc4)=CC=CC3O)c(F)c2)C(=O)O1 |
| InChI | InChI=1S/C25H23FN4O6/c1-15(31)27-13-20-14-29(25(33)36-20)19-9-10-22(21(26)12-19)28-23-11-17(3-2-4-24(23)32)16-5-7-18(8-6-16)30(34)35/h2-12,20,24,28,32H,13-14H2,1H3,(H,27,31)/t20-,24?/m0/s1 |
| InChIKey | DIDXRSBODNAAMT-QHELBMECSA-N |
| XLogP | 3.51 |
| TPSA | 134.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.48 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|