C19H17FN4O7 — CID 6475968
N-[4-[(5S)-5-(acetamidomethyl)-2-oxo-1,3-oxazolidin-3-yl]-2-fluorophenyl]-5-[(E)-2-nitroethenyl]furan-2-carboxamide (PubChem CID 6475968) has the molecular formula C19H17FN4O7 and a molecular weight of 432.36 g/mol. Its IUPAC name is N-[4-[(5S)-5-(acetamidomethyl)-2-oxo-1,3-oxazolidin-3-yl]-2-fluorophenyl]-5-[(E)-2-nitroethenyl]furan-2-carboxamide.
| Compound Name | N-[4-[(5S)-5-(acetamidomethyl)-2-oxo-1,3-oxazolidin-3-yl]-2-fluorophenyl]-5-[(E)-2-nitroethenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 6475968 |
| Molecular Formula | C19H17FN4O7 |
| Molecular Weight | 432.36 g/mol |
| Exact Mass | 432.11 |
| IUPAC Name | N-[4-[(5S)-5-(acetamidomethyl)-2-oxo-1,3-oxazolidin-3-yl]-2-fluorophenyl]-5-[(E)-2-nitroethenyl]furan-2-carboxamide |
| SMILES | CC(=O)NC[C@H]1CN(c2ccc(NC(=O)c3ccc(/C=C/[N+](=O)[O-])o3)c(F)c2)C(=O)O1 |
| InChI | InChI=1S/C19H17FN4O7/c1-11(25)21-9-14-10-23(19(27)31-14)12-2-4-16(15(20)8-12)22-18(26)17-5-3-13(30-17)6-7-24(28)29/h2-8,14H,9-10H2,1H3,(H,21,25)(H,22,26)/b7-6+/t14-/m0/s1 |
| InChIKey | VNUGUOTVSCCUHH-UZYOAWRESA-N |
| XLogP | 2.38 |
| TPSA | 144.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.36 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|