C18H19FN4O5S — CID 10432351
N-[[(5S)-3-[4-[(4-aminophenyl)sulfonylamino]-3-fluorophenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]acetamide (PubChem CID 10432351) has the molecular formula C18H19FN4O5S and a molecular weight of 422.44 g/mol. Its IUPAC name is N-[[(5S)-3-[4-[(4-aminophenyl)sulfonylamino]-3-fluorophenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]acetamide.
| Compound Name | N-[[(5S)-3-[4-[(4-aminophenyl)sulfonylamino]-3-fluorophenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]acetamide |
|---|---|
| PubChem CID | 10432351 |
| Molecular Formula | C18H19FN4O5S |
| Molecular Weight | 422.44 g/mol |
| Exact Mass | 422.11 |
| IUPAC Name | N-[[(5S)-3-[4-[(4-aminophenyl)sulfonylamino]-3-fluorophenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]acetamide |
| SMILES | CC(=O)NC[C@H]1CN(c2ccc(NS(=O)(=O)c3ccc(N)cc3)c(F)c2)C(=O)O1 |
| InChI | InChI=1S/C18H19FN4O5S/c1-11(24)21-9-14-10-23(18(25)28-14)13-4-7-17(16(19)8-13)22-29(26,27)15-5-2-12(20)3-6-15/h2-8,14,22H,9-10,20H2,1H3,(H,21,24)/t14-/m0/s1 |
| InChIKey | SLPSNESPCUMKSP-AWEZNQCLSA-N |
| XLogP | 1.67 |
| TPSA | 130.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.44 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|