C20H18FN3O5 — CID 24809592
N-[[(5S)-3-[3-fluoro-4-[4-[(E)-2-nitroethenyl]phenyl]phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]acetamide (PubChem CID 24809592) has the molecular formula C20H18FN3O5 and a molecular weight of 399.38 g/mol. Its IUPAC name is N-[[(5S)-3-[3-fluoro-4-[4-[(E)-2-nitroethenyl]phenyl]phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]acetamide.
| Compound Name | N-[[(5S)-3-[3-fluoro-4-[4-[(E)-2-nitroethenyl]phenyl]phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]acetamide |
|---|---|
| PubChem CID | 24809592 |
| Molecular Formula | C20H18FN3O5 |
| Molecular Weight | 399.38 g/mol |
| Exact Mass | 399.12 |
| IUPAC Name | N-[[(5S)-3-[3-fluoro-4-[4-[(E)-2-nitroethenyl]phenyl]phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]acetamide |
| SMILES | CC(=O)NC[C@H]1CN(c2ccc(-c3ccc(/C=C/[N+](=O)[O-])cc3)c(F)c2)C(=O)O1 |
| InChI | InChI=1S/C20H18FN3O5/c1-13(25)22-11-17-12-23(20(26)29-17)16-6-7-18(19(21)10-16)15-4-2-14(3-5-15)8-9-24(27)28/h2-10,17H,11-12H2,1H3,(H,22,25)/b9-8+/t17-/m0/s1 |
| InChIKey | GMEQFQZXWSOUDU-IJDCCNJMSA-N |
| XLogP | 3.20 |
| TPSA | 101.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.38 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|