C20H19F4N3O2S — CID 11189918
N-[[(5S)-3-[3-fluoro-4-[methyl-[(2,4,6-trifluorophenyl)methyl]amino]phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]ethanethioamide (PubChem CID 11189918) has the molecular formula C20H19F4N3O2S and a molecular weight of 441.45 g/mol. Its IUPAC name is N-[[(5S)-3-[3-fluoro-4-[methyl-[(2,4,6-trifluorophenyl)methyl]amino]phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]ethanethioamide.
| Compound Name | N-[[(5S)-3-[3-fluoro-4-[methyl-[(2,4,6-trifluorophenyl)methyl]amino]phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]ethanethioamide |
|---|---|
| PubChem CID | 11189918 |
| Molecular Formula | C20H19F4N3O2S |
| Molecular Weight | 441.45 g/mol |
| Exact Mass | 441.11 |
| IUPAC Name | N-[[(5S)-3-[3-fluoro-4-[methyl-[(2,4,6-trifluorophenyl)methyl]amino]phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]ethanethioamide |
| SMILES | CC(=S)NC[C@H]1CN(c2ccc(N(C)Cc3c(F)cc(F)cc3F)c(F)c2)C(=O)O1 |
| InChI | InChI=1S/C20H19F4N3O2S/c1-11(30)25-8-14-9-27(20(28)29-14)13-3-4-19(18(24)7-13)26(2)10-15-16(22)5-12(21)6-17(15)23/h3-7,14H,8-10H2,1-2H3,(H,25,30)/t14-/m0/s1 |
| InChIKey | KYOYGQNTKBOSPD-AWEZNQCLSA-N |
| XLogP | 4.14 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.45 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|