C20H22FN5O6S — CID 11477146
methyl N-[[(5S)-3-[3-fluoro-4-[4-(5-nitrothiophen-2-yl)piperazin-1-yl]phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]carbamate (PubChem CID 11477146) has the molecular formula C20H22FN5O6S and a molecular weight of 479.49 g/mol. Its IUPAC name is methyl N-[[(5S)-3-[3-fluoro-4-[4-(5-nitrothiophen-2-yl)piperazin-1-yl]phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]carbamate.
| Compound Name | methyl N-[[(5S)-3-[3-fluoro-4-[4-(5-nitrothiophen-2-yl)piperazin-1-yl]phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]carbamate |
|---|---|
| PubChem CID | 11477146 |
| Molecular Formula | C20H22FN5O6S |
| Molecular Weight | 479.49 g/mol |
| Exact Mass | 479.13 |
| IUPAC Name | methyl N-[[(5S)-3-[3-fluoro-4-[4-(5-nitrothiophen-2-yl)piperazin-1-yl]phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]carbamate |
| SMILES | COC(=O)NC[C@H]1CN(c2ccc(N3CCN(c4ccc([N+](=O)[O-])s4)CC3)c(F)c2)C(=O)O1 |
| InChI | InChI=1S/C20H22FN5O6S/c1-31-19(27)22-11-14-12-25(20(28)32-14)13-2-3-16(15(21)10-13)23-6-8-24(9-7-23)17-4-5-18(33-17)26(29)30/h2-5,10,14H,6-9,11-12H2,1H3,(H,22,27)/t14-/m0/s1 |
| InChIKey | HHFKVCRSNITESK-AWEZNQCLSA-N |
| XLogP | 2.80 |
| TPSA | 117.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.49 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|