C25H24FN5O8S2 — CID 90897799
[(5R)-3-[3-fluoro-4-[4-(5-nitrothiophen-2-yl)piperazin-1-yl]phenyl]-2-oxo-1,3-oxazolidin-5-yl]methylcarbamoyl benzenesulfonate (PubChem CID 90897799) has the molecular formula C25H24FN5O8S2 and a molecular weight of 605.63 g/mol. Its IUPAC name is [(5R)-3-[3-fluoro-4-[4-(5-nitrothiophen-2-yl)piperazin-1-yl]phenyl]-2-oxo-1,3-oxazolidin-5-yl]methylcarbamoyl benzenesulfonate.
| Compound Name | [(5R)-3-[3-fluoro-4-[4-(5-nitrothiophen-2-yl)piperazin-1-yl]phenyl]-2-oxo-1,3-oxazolidin-5-yl]methylcarbamoyl benzenesulfonate |
|---|---|
| PubChem CID | 90897799 |
| Molecular Formula | C25H24FN5O8S2 |
| Molecular Weight | 605.63 g/mol |
| Exact Mass | 605.11 |
| IUPAC Name | [(5R)-3-[3-fluoro-4-[4-(5-nitrothiophen-2-yl)piperazin-1-yl]phenyl]-2-oxo-1,3-oxazolidin-5-yl]methylcarbamoyl benzenesulfonate |
| SMILES | O=C(NC[C@@H]1CN(c2ccc(N3CCN(c4ccc([N+](=O)[O-])s4)CC3)c(F)c2)C(=O)O1)OS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C25H24FN5O8S2/c26-20-14-17(6-7-21(20)28-10-12-29(13-11-28)22-8-9-23(40-22)31(34)35)30-16-18(38-25(30)33)15-27-24(32)39-41(36,37)19-4-2-1-3-5-19/h1-9,14,18H,10-13,15-16H2,(H,27,32)/t18-/m1/s1 |
| InChIKey | CPYNVAAPVXFREQ-GOSISDBHSA-N |
| XLogP | 3.56 |
| TPSA | 151.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.63 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|