C26H29N3O5 — CID 161221524
3-methoxyaniline;N-[[3-(3-methoxy-4-phenylphenyl)-2-oxo-1,3-oxazolidin-5-yl]methyl]acetamide (PubChem CID 161221524) has the molecular formula C26H29N3O5 and a molecular weight of 463.53 g/mol. Its IUPAC name is 3-methoxyaniline;N-[[3-(3-methoxy-4-phenylphenyl)-2-oxo-1,3-oxazolidin-5-yl]methyl]acetamide.
| Compound Name | 3-methoxyaniline;N-[[3-(3-methoxy-4-phenylphenyl)-2-oxo-1,3-oxazolidin-5-yl]methyl]acetamide |
|---|---|
| PubChem CID | 161221524 |
| Molecular Formula | C26H29N3O5 |
| Molecular Weight | 463.53 g/mol |
| Exact Mass | 463.21 |
| IUPAC Name | 3-methoxyaniline;N-[[3-(3-methoxy-4-phenylphenyl)-2-oxo-1,3-oxazolidin-5-yl]methyl]acetamide |
| SMILES | COc1cc(N2CC(CNC(C)=O)OC2=O)ccc1-c1ccccc1.COc1cccc(N)c1 |
| InChI | InChI=1S/C19H20N2O4.C7H9NO/c1-13(22)20-11-16-12-21(19(23)25-16)15-8-9-17(18(10-15)24-2)14-6-4-3-5-7-14;1-9-7-4-2-3-6(8)5-7/h3-10,16H,11-12H2,1-2H3,(H,20,22);2-5H,8H2,1H3 |
| InChIKey | UXOOOCCSFVDYIH-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 103.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.53 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|