C12H13IN2O4 — CID 57061555
N-[[(5S)-3-(3-hydroxy-4-iodophenyl)-2-oxo-1,3-oxazolidin-5-yl]methyl]acetamide (PubChem CID 57061555) has the molecular formula C12H13IN2O4 and a molecular weight of 376.15 g/mol. Its IUPAC name is N-[[(5S)-3-(3-hydroxy-4-iodophenyl)-2-oxo-1,3-oxazolidin-5-yl]methyl]acetamide.
| Compound Name | N-[[(5S)-3-(3-hydroxy-4-iodophenyl)-2-oxo-1,3-oxazolidin-5-yl]methyl]acetamide |
|---|---|
| PubChem CID | 57061555 |
| Molecular Formula | C12H13IN2O4 |
| Molecular Weight | 376.15 g/mol |
| Exact Mass | 375.99 |
| IUPAC Name | N-[[(5S)-3-(3-hydroxy-4-iodophenyl)-2-oxo-1,3-oxazolidin-5-yl]methyl]acetamide |
| SMILES | CC(=O)NC[C@H]1CN(c2ccc(I)c(O)c2)C(=O)O1 |
| InChI | InChI=1S/C12H13IN2O4/c1-7(16)14-5-9-6-15(12(18)19-9)8-2-3-10(13)11(17)4-8/h2-4,9,17H,5-6H2,1H3,(H,14,16)/t9-/m0/s1 |
| InChIKey | ADALCLYJJVHXPO-VIFPVBQESA-N |
| XLogP | 1.46 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.15 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|