C19H24Cl2N4O2 — CID 168978957
tert-butyl (2S,6R)-4-(5,7-dichloro-1,8-naphthyridin-3-yl)-2,6-dimethylpiperazine-1-carboxylate (PubChem CID 168978957) has the molecular formula C19H24Cl2N4O2 and a molecular weight of 411.33 g/mol. Its IUPAC name is tert-butyl (2S,6R)-4-(5,7-dichloro-1,8-naphthyridin-3-yl)-2,6-dimethylpiperazine-1-carboxylate.
| Compound Name | tert-butyl (2S,6R)-4-(5,7-dichloro-1,8-naphthyridin-3-yl)-2,6-dimethylpiperazine-1-carboxylate |
|---|---|
| PubChem CID | 168978957 |
| Molecular Formula | C19H24Cl2N4O2 |
| Molecular Weight | 411.33 g/mol |
| Exact Mass | 410.13 |
| IUPAC Name | tert-butyl (2S,6R)-4-(5,7-dichloro-1,8-naphthyridin-3-yl)-2,6-dimethylpiperazine-1-carboxylate |
| SMILES | C[C@@H]1CN(c2cnc3nc(Cl)cc(Cl)c3c2)C[C@H](C)N1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C19H24Cl2N4O2/c1-11-9-24(10-12(2)25(11)18(26)27-19(3,4)5)13-6-14-15(20)7-16(21)23-17(14)22-8-13/h6-8,11-12H,9-10H2,1-5H3/t11-,12+ |
| InChIKey | XISLCPWTKOETQA-TXEJJXNPSA-N |
| XLogP | 4.77 |
| TPSA | 58.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.33 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|