C20H25F3N4O5S — CID 168978788
tert-butyl (2R,6S)-2,6-dimethyl-4-[7-(trifluoromethylsulfonyloxy)-1,8-naphthyridin-3-yl]piperazine-1-carboxylate (PubChem CID 168978788) has the molecular formula C20H25F3N4O5S and a molecular weight of 490.50 g/mol. Its IUPAC name is tert-butyl (2R,6S)-2,6-dimethyl-4-[7-(trifluoromethylsulfonyloxy)-1,8-naphthyridin-3-yl]piperazine-1-carboxylate.
| Compound Name | tert-butyl (2R,6S)-2,6-dimethyl-4-[7-(trifluoromethylsulfonyloxy)-1,8-naphthyridin-3-yl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 168978788 |
| Molecular Formula | C20H25F3N4O5S |
| Molecular Weight | 490.50 g/mol |
| Exact Mass | 490.15 |
| IUPAC Name | tert-butyl (2R,6S)-2,6-dimethyl-4-[7-(trifluoromethylsulfonyloxy)-1,8-naphthyridin-3-yl]piperazine-1-carboxylate |
| SMILES | C[C@@H]1CN(c2cnc3nc(OS(=O)(=O)C(F)(F)F)ccc3c2)C[C@H](C)N1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C20H25F3N4O5S/c1-12-10-26(11-13(2)27(12)18(28)31-19(3,4)5)15-8-14-6-7-16(25-17(14)24-9-15)32-33(29,30)20(21,22)23/h6-9,12-13H,10-11H2,1-5H3/t12-,13+ |
| InChIKey | BOMZHQCMFTYIOL-BETUJISGSA-N |
| XLogP | 3.69 |
| TPSA | 101.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.50 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|