C19H22ClF3N4O5S — CID 168978962
tert-butyl (2S)-4-[4-chloro-7-(trifluoromethylsulfonyloxy)-1,8-naphthyridin-3-yl]-2-methylpiperazine-1-carboxylate (PubChem CID 168978962) has the molecular formula C19H22ClF3N4O5S and a molecular weight of 510.92 g/mol. Its IUPAC name is tert-butyl (2S)-4-[4-chloro-7-(trifluoromethylsulfonyloxy)-1,8-naphthyridin-3-yl]-2-methylpiperazine-1-carboxylate.
| Compound Name | tert-butyl (2S)-4-[4-chloro-7-(trifluoromethylsulfonyloxy)-1,8-naphthyridin-3-yl]-2-methylpiperazine-1-carboxylate |
|---|---|
| PubChem CID | 168978962 |
| Molecular Formula | C19H22ClF3N4O5S |
| Molecular Weight | 510.92 g/mol |
| Exact Mass | 510.10 |
| IUPAC Name | tert-butyl (2S)-4-[4-chloro-7-(trifluoromethylsulfonyloxy)-1,8-naphthyridin-3-yl]-2-methylpiperazine-1-carboxylate |
| SMILES | C[C@H]1CN(c2cnc3nc(OS(=O)(=O)C(F)(F)F)ccc3c2Cl)CCN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C19H22ClF3N4O5S/c1-11-10-26(7-8-27(11)17(28)31-18(2,3)4)13-9-24-16-12(15(13)20)5-6-14(25-16)32-33(29,30)19(21,22)23/h5-6,9,11H,7-8,10H2,1-4H3/t11-/m0/s1 |
| InChIKey | MQDADUBAXWMMGX-NSHDSACASA-N |
| XLogP | 3.96 |
| TPSA | 101.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.92 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|