C19H23F3N4O5S — CID 168978860
tert-butyl 4-[[7-(trifluoromethylsulfonyloxy)-1,8-naphthyridin-3-yl]amino]piperidine-1-carboxylate (PubChem CID 168978860) has the molecular formula C19H23F3N4O5S and a molecular weight of 476.48 g/mol. Its IUPAC name is tert-butyl 4-[[7-(trifluoromethylsulfonyloxy)-1,8-naphthyridin-3-yl]amino]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[[7-(trifluoromethylsulfonyloxy)-1,8-naphthyridin-3-yl]amino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 168978860 |
| Molecular Formula | C19H23F3N4O5S |
| Molecular Weight | 476.48 g/mol |
| Exact Mass | 476.13 |
| IUPAC Name | tert-butyl 4-[[7-(trifluoromethylsulfonyloxy)-1,8-naphthyridin-3-yl]amino]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(Nc2cnc3nc(OS(=O)(=O)C(F)(F)F)ccc3c2)CC1 |
| InChI | InChI=1S/C19H23F3N4O5S/c1-18(2,3)30-17(27)26-8-6-13(7-9-26)24-14-10-12-4-5-15(25-16(12)23-11-14)31-32(28,29)19(20,21)22/h4-5,10-11,13,24H,6-9H2,1-3H3 |
| InChIKey | AFVRPUWNDGKILN-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 110.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.48 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|