C24H30N4O4S — CID 86696183
tert-butyl 4-[[6-(5-methylsulfonylindol-1-yl)-3-pyridinyl]amino]piperidine-1-carboxylate (PubChem CID 86696183) has the molecular formula C24H30N4O4S and a molecular weight of 470.60 g/mol. Its IUPAC name is tert-butyl 4-[[6-(5-methylsulfonylindol-1-yl)-3-pyridinyl]amino]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[[6-(5-methylsulfonylindol-1-yl)-3-pyridinyl]amino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 86696183 |
| Molecular Formula | C24H30N4O4S |
| Molecular Weight | 470.60 g/mol |
| Exact Mass | 470.20 |
| IUPAC Name | tert-butyl 4-[[6-(5-methylsulfonylindol-1-yl)-3-pyridinyl]amino]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(Nc2ccc(-n3ccc4cc(S(C)(=O)=O)ccc43)nc2)CC1 |
| InChI | InChI=1S/C24H30N4O4S/c1-24(2,3)32-23(29)27-12-10-18(11-13-27)26-19-5-8-22(25-16-19)28-14-9-17-15-20(33(4,30)31)6-7-21(17)28/h5-9,14-16,18,26H,10-13H2,1-4H3 |
| InChIKey | QUCWUGMMEPJQPC-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 93.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.60 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |