C24H30N4O4S — CID 53341488
tert-butyl 4-[5-[(5-methylsulfonylindol-1-yl)methyl]pyrazin-2-yl]piperidine-1-carboxylate (PubChem CID 53341488) has the molecular formula C24H30N4O4S and a molecular weight of 470.60 g/mol. Its IUPAC name is tert-butyl 4-[5-[(5-methylsulfonylindol-1-yl)methyl]pyrazin-2-yl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[5-[(5-methylsulfonylindol-1-yl)methyl]pyrazin-2-yl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 53341488 |
| Molecular Formula | C24H30N4O4S |
| Molecular Weight | 470.60 g/mol |
| Exact Mass | 470.20 |
| IUPAC Name | tert-butyl 4-[5-[(5-methylsulfonylindol-1-yl)methyl]pyrazin-2-yl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(c2cnc(Cn3ccc4cc(S(C)(=O)=O)ccc43)cn2)CC1 |
| InChI | InChI=1S/C24H30N4O4S/c1-24(2,3)32-23(29)27-10-7-17(8-11-27)21-15-25-19(14-26-21)16-28-12-9-18-13-20(33(4,30)31)5-6-22(18)28/h5-6,9,12-15,17H,7-8,10-11,16H2,1-4H3 |
| InChIKey | PXRWDSPKRQPLFS-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 94.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.60 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |