C22H29N3O5S — CID 123275895
tert-butyl 4-[6-[(4-methylsulfonylphenoxy)methyl]pyridazin-3-yl]piperidine-1-carboxylate (PubChem CID 123275895) has the molecular formula C22H29N3O5S and a molecular weight of 447.56 g/mol. Its IUPAC name is tert-butyl 4-[6-[(4-methylsulfonylphenoxy)methyl]pyridazin-3-yl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[6-[(4-methylsulfonylphenoxy)methyl]pyridazin-3-yl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 123275895 |
| Molecular Formula | C22H29N3O5S |
| Molecular Weight | 447.56 g/mol |
| Exact Mass | 447.18 |
| IUPAC Name | tert-butyl 4-[6-[(4-methylsulfonylphenoxy)methyl]pyridazin-3-yl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(c2ccc(COc3ccc(S(C)(=O)=O)cc3)nn2)CC1 |
| InChI | InChI=1S/C22H29N3O5S/c1-22(2,3)30-21(26)25-13-11-16(12-14-25)20-10-5-17(23-24-20)15-29-18-6-8-19(9-7-18)31(4,27)28/h5-10,16H,11-15H2,1-4H3 |
| InChIKey | NUWITVBUHPWSQR-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 98.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.56 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |