C21H33NO5S — CID 67184502
tert-butyl 4-[(3R)-3-(4-methylsulfonylphenoxy)butyl]piperidine-1-carboxylate (PubChem CID 67184502) has the molecular formula C21H33NO5S and a molecular weight of 411.56 g/mol. Its IUPAC name is tert-butyl 4-[(3R)-3-(4-methylsulfonylphenoxy)butyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[(3R)-3-(4-methylsulfonylphenoxy)butyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 67184502 |
| Molecular Formula | C21H33NO5S |
| Molecular Weight | 411.56 g/mol |
| Exact Mass | 411.21 |
| IUPAC Name | tert-butyl 4-[(3R)-3-(4-methylsulfonylphenoxy)butyl]piperidine-1-carboxylate |
| SMILES | C[C@H](CCC1CCN(C(=O)OC(C)(C)C)CC1)Oc1ccc(S(C)(=O)=O)cc1 |
| InChI | InChI=1S/C21H33NO5S/c1-16(26-18-8-10-19(11-9-18)28(5,24)25)6-7-17-12-14-22(15-13-17)20(23)27-21(2,3)4/h8-11,16-17H,6-7,12-15H2,1-5H3/t16-/m1/s1 |
| InChIKey | LKSUYXITALIYPV-MRXNPFEDSA-N |
| XLogP | 4.28 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.56 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |