C17H25NO5S — CID 67183247
4-[(3R)-3-(4-methylsulfonylphenoxy)butyl]piperidine-1-carboxylic acid (PubChem CID 67183247) has the molecular formula C17H25NO5S and a molecular weight of 355.46 g/mol. Its IUPAC name is 4-[(3R)-3-(4-methylsulfonylphenoxy)butyl]piperidine-1-carboxylic acid.
| Compound Name | 4-[(3R)-3-(4-methylsulfonylphenoxy)butyl]piperidine-1-carboxylic acid |
|---|---|
| PubChem CID | 67183247 |
| Molecular Formula | C17H25NO5S |
| Molecular Weight | 355.46 g/mol |
| Exact Mass | 355.15 |
| IUPAC Name | 4-[(3R)-3-(4-methylsulfonylphenoxy)butyl]piperidine-1-carboxylic acid |
| SMILES | C[C@H](CCC1CCN(C(=O)O)CC1)Oc1ccc(S(C)(=O)=O)cc1 |
| InChI | InChI=1S/C17H25NO5S/c1-13(3-4-14-9-11-18(12-10-14)17(19)20)23-15-5-7-16(8-6-15)24(2,21)22/h5-8,13-14H,3-4,9-12H2,1-2H3,(H,19,20)/t13-/m1/s1 |
| InChIKey | XLIDBAOGSFRTDH-CYBMUJFWSA-N |
| XLogP | 3.03 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.46 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |