C12H16N2O4S — CID 142325530
(4-methylsulfonylphenyl) (3R)-3-aminopyrrolidine-1-carboxylate (PubChem CID 142325530) has the molecular formula C12H16N2O4S and a molecular weight of 284.34 g/mol. Its IUPAC name is (4-methylsulfonylphenyl) (3R)-3-aminopyrrolidine-1-carboxylate.
| Compound Name | (4-methylsulfonylphenyl) (3R)-3-aminopyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 142325530 |
| Molecular Formula | C12H16N2O4S |
| Molecular Weight | 284.34 g/mol |
| Exact Mass | 284.08 |
| IUPAC Name | (4-methylsulfonylphenyl) (3R)-3-aminopyrrolidine-1-carboxylate |
| SMILES | CS(=O)(=O)c1ccc(OC(=O)N2CC[C@@H](N)C2)cc1 |
| InChI | InChI=1S/C12H16N2O4S/c1-19(16,17)11-4-2-10(3-5-11)18-12(15)14-7-6-9(13)8-14/h2-5,9H,6-8,13H2,1H3/t9-/m1/s1 |
| InChIKey | LSYQHJXHXCOEPO-SECBINFHSA-N |
| XLogP | 0.62 |
| TPSA | 89.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.34 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |