About (4-ethylphenyl) 3-aminoazetidine-1-carboxylate
(4-ethylphenyl) 3-aminoazetidine-1-carboxylate (PubChem CID 83822345) has the molecular formula C12H16N2O2
and a molecular weight of 220.27 g/mol. Its IUPAC name is (4-ethylphenyl) 3-aminoazetidine-1-carboxylate.
Molecular Properties
| Compound Name | (4-ethylphenyl) 3-aminoazetidine-1-carboxylate |
| PubChem CID | 83822345 |
| Molecular Formula | C12H16N2O2 |
| Molecular Weight | 220.27 g/mol |
| Exact Mass | 220.12 |
| IUPAC Name | (4-ethylphenyl) 3-aminoazetidine-1-carboxylate |
| SMILES | CCc1ccc(OC(=O)N2CC(N)C2)cc1 |
| InChI | InChI=1S/C12H16N2O2/c1-2-9-3-5-11(6-4-9)16-12(15)14-7-10(13)8-14/h3-6,10H,2,7-8,13H2,1H3 |
| InChIKey | XUKJQFWQTOFSJR-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.27 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (4-ethylphenyl) 3-aminoazetidine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-ethylphenyl) 3-aminoazetidine-1-carboxylate?
The IUPAC name of (4-ethylphenyl) 3-aminoazetidine-1-carboxylate (CID 83822345) is (4-ethylphenyl) 3-aminoazetidine-1-carboxylate.
What is the SMILES notation for (4-ethylphenyl) 3-aminoazetidine-1-carboxylate?
The canonical SMILES for (4-ethylphenyl) 3-aminoazetidine-1-carboxylate is CCc1ccc(OC(=O)N2CC(N)C2)cc1.
What is the InChIKey of (4-ethylphenyl) 3-aminoazetidine-1-carboxylate?
The InChIKey is XUKJQFWQTOFSJR-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16N2O2/c1-2-9-3-5-11(6-4-9)16-12(15)14-7-10(13)8-14/h3-6,10H,2,7-8,13H2,1H3.
What are the key properties of (4-ethylphenyl) 3-aminoazetidine-1-carboxylate?
(4-ethylphenyl) 3-aminoazetidine-1-carboxylate has a molecular weight of 220.27 g/mol, XLogP of 1.39, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4-ethylphenyl) 3-aminoazetidine-1-carboxylate is sourced from PubChem (CID 83822345), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).