C21H21ClN2O3 — CID 162438921
(4-ethylphenyl) 4-(3-chloro-4-cyanophenoxy)piperidine-1-carboxylate (PubChem CID 162438921) has the molecular formula C21H21ClN2O3 and a molecular weight of 384.86 g/mol. Its IUPAC name is (4-ethylphenyl) 4-(3-chloro-4-cyanophenoxy)piperidine-1-carboxylate.
| Compound Name | (4-ethylphenyl) 4-(3-chloro-4-cyanophenoxy)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 162438921 |
| Molecular Formula | C21H21ClN2O3 |
| Molecular Weight | 384.86 g/mol |
| Exact Mass | 384.12 |
| IUPAC Name | (4-ethylphenyl) 4-(3-chloro-4-cyanophenoxy)piperidine-1-carboxylate |
| SMILES | CCc1ccc(OC(=O)N2CCC(Oc3ccc(C#N)c(Cl)c3)CC2)cc1 |
| InChI | InChI=1S/C21H21ClN2O3/c1-2-15-3-6-17(7-4-15)27-21(25)24-11-9-18(10-12-24)26-19-8-5-16(14-23)20(22)13-19/h3-8,13,18H,2,9-12H2,1H3 |
| InChIKey | SKZJPQUZXVTDGW-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 62.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.86 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |