C20H19ClN2O3 — CID 170513726
(4-methylphenyl) 4-(3-chloro-4-isocyanophenoxy)piperidine-1-carboxylate (PubChem CID 170513726) has the molecular formula C20H19ClN2O3 and a molecular weight of 370.84 g/mol. Its IUPAC name is (4-methylphenyl) 4-(3-chloro-4-isocyanophenoxy)piperidine-1-carboxylate.
| Compound Name | (4-methylphenyl) 4-(3-chloro-4-isocyanophenoxy)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 170513726 |
| Molecular Formula | C20H19ClN2O3 |
| Molecular Weight | 370.84 g/mol |
| Exact Mass | 370.11 |
| IUPAC Name | (4-methylphenyl) 4-(3-chloro-4-isocyanophenoxy)piperidine-1-carboxylate |
| SMILES | [C-]#[N+]c1ccc(OC2CCN(C(=O)Oc3ccc(C)cc3)CC2)cc1Cl |
| InChI | InChI=1S/C20H19ClN2O3/c1-14-3-5-15(6-4-14)26-20(24)23-11-9-16(10-12-23)25-17-7-8-19(22-2)18(21)13-17/h3-8,13,16H,9-12H2,1H3 |
| InChIKey | AIRRCAFOBFONGT-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 43.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.84 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|