C22H25ClN4O2 — CID 177120319
6-tert-butyl-N-[4-(3-chloro-4-isocyanophenoxy)cyclohexyl]pyridazine-3-carboxamide (PubChem CID 177120319) has the molecular formula C22H25ClN4O2 and a molecular weight of 412.92 g/mol. Its IUPAC name is 6-tert-butyl-N-[4-(3-chloro-4-isocyanophenoxy)cyclohexyl]pyridazine-3-carboxamide.
| Compound Name | 6-tert-butyl-N-[4-(3-chloro-4-isocyanophenoxy)cyclohexyl]pyridazine-3-carboxamide |
|---|---|
| PubChem CID | 177120319 |
| Molecular Formula | C22H25ClN4O2 |
| Molecular Weight | 412.92 g/mol |
| Exact Mass | 412.17 |
| IUPAC Name | 6-tert-butyl-N-[4-(3-chloro-4-isocyanophenoxy)cyclohexyl]pyridazine-3-carboxamide |
| SMILES | [C-]#[N+]c1ccc(OC2CCC(NC(=O)c3ccc(C(C)(C)C)nn3)CC2)cc1Cl |
| InChI | InChI=1S/C22H25ClN4O2/c1-22(2,3)20-12-11-19(26-27-20)21(28)25-14-5-7-15(8-6-14)29-16-9-10-18(24-4)17(23)13-16/h9-15H,5-8H2,1-3H3,(H,25,28) |
| InChIKey | URLRXOMGHDAWAI-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 68.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.92 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|