C24H27ClN6O2 — CID 167417174
5-(2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl)-N-[4-(3-chloro-4-isocyanophenoxy)cyclohexyl]pyrazine-2-carboxamide (PubChem CID 167417174) has the molecular formula C24H27ClN6O2 and a molecular weight of 466.97 g/mol. Its IUPAC name is 5-(2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl)-N-[4-(3-chloro-4-isocyanophenoxy)cyclohexyl]pyrazine-2-carboxamide.
| Compound Name | 5-(2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl)-N-[4-(3-chloro-4-isocyanophenoxy)cyclohexyl]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 167417174 |
| Molecular Formula | C24H27ClN6O2 |
| Molecular Weight | 466.97 g/mol |
| Exact Mass | 466.19 |
| IUPAC Name | 5-(2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl)-N-[4-(3-chloro-4-isocyanophenoxy)cyclohexyl]pyrazine-2-carboxamide |
| SMILES | [C-]#[N+]c1ccc(OC2CCC(NC(=O)c3cnc(N4CC5CNCC5C4)cn3)CC2)cc1Cl |
| InChI | InChI=1S/C24H27ClN6O2/c1-26-21-7-6-19(8-20(21)25)33-18-4-2-17(3-5-18)30-24(32)22-11-29-23(12-28-22)31-13-15-9-27-10-16(15)14-31/h6-8,11-12,15-18,27H,2-5,9-10,13-14H2,(H,30,32) |
| InChIKey | YJTKIOCECLTKAI-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 83.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.97 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|