C18H16Cl2N4O2 — CID 155212260
5-chloro-N-[4-(3-chloro-4-cyanophenoxy)cyclohexyl]pyrazine-2-carboxamide (PubChem CID 155212260) has the molecular formula C18H16Cl2N4O2 and a molecular weight of 391.26 g/mol. Its IUPAC name is 5-chloro-N-[4-(3-chloro-4-cyanophenoxy)cyclohexyl]pyrazine-2-carboxamide.
| Compound Name | 5-chloro-N-[4-(3-chloro-4-cyanophenoxy)cyclohexyl]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 155212260 |
| Molecular Formula | C18H16Cl2N4O2 |
| Molecular Weight | 391.26 g/mol |
| Exact Mass | 390.07 |
| IUPAC Name | 5-chloro-N-[4-(3-chloro-4-cyanophenoxy)cyclohexyl]pyrazine-2-carboxamide |
| SMILES | N#Cc1ccc(OC2CCC(NC(=O)c3cnc(Cl)cn3)CC2)cc1Cl |
| InChI | InChI=1S/C18H16Cl2N4O2/c19-15-7-14(4-1-11(15)8-21)26-13-5-2-12(3-6-13)24-18(25)16-9-23-17(20)10-22-16/h1,4,7,9-10,12-13H,2-3,5-6H2,(H,24,25) |
| InChIKey | BQBAAYVHFGZIPF-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 87.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.26 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |