C22H23ClN2O3 — CID 169195596
N-[4-(3-chloro-4-cyanophenoxy)cyclohexyl]-4-(2-hydroxyethyl)benzamide (PubChem CID 169195596) has the molecular formula C22H23ClN2O3 and a molecular weight of 398.89 g/mol. Its IUPAC name is N-[4-(3-chloro-4-cyanophenoxy)cyclohexyl]-4-(2-hydroxyethyl)benzamide.
| Compound Name | N-[4-(3-chloro-4-cyanophenoxy)cyclohexyl]-4-(2-hydroxyethyl)benzamide |
|---|---|
| PubChem CID | 169195596 |
| Molecular Formula | C22H23ClN2O3 |
| Molecular Weight | 398.89 g/mol |
| Exact Mass | 398.14 |
| IUPAC Name | N-[4-(3-chloro-4-cyanophenoxy)cyclohexyl]-4-(2-hydroxyethyl)benzamide |
| SMILES | N#Cc1ccc(OC2CCC(NC(=O)c3ccc(CCO)cc3)CC2)cc1Cl |
| InChI | InChI=1S/C22H23ClN2O3/c23-21-13-20(8-5-17(21)14-24)28-19-9-6-18(7-10-19)25-22(27)16-3-1-15(2-4-16)11-12-26/h1-5,8,13,18-19,26H,6-7,9-12H2,(H,25,27) |
| InChIKey | RKBFBXYMOZUMTM-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 82.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.89 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |