C27H29ClN2O2 — CID 171070401
(1E,3Z,5Z,7Z)-N-[4-(3-chloro-4-cyanophenoxy)cyclohexyl]-6-cyclopentylcycloocta-1,3,5,7-tetraene-1-carboxamide (PubChem CID 171070401) has the molecular formula C27H29ClN2O2 and a molecular weight of 448.99 g/mol. Its IUPAC name is (1E,3Z,5Z,7Z)-N-[4-(3-chloro-4-cyanophenoxy)cyclohexyl]-6-cyclopentylcycloocta-1,3,5,7-tetraene-1-carboxamide.
| Compound Name | (1E,3Z,5Z,7Z)-N-[4-(3-chloro-4-cyanophenoxy)cyclohexyl]-6-cyclopentylcycloocta-1,3,5,7-tetraene-1-carboxamide |
|---|---|
| PubChem CID | 171070401 |
| Molecular Formula | C27H29ClN2O2 |
| Molecular Weight | 448.99 g/mol |
| Exact Mass | 448.19 |
| IUPAC Name | (1E,3Z,5Z,7Z)-N-[4-(3-chloro-4-cyanophenoxy)cyclohexyl]-6-cyclopentylcycloocta-1,3,5,7-tetraene-1-carboxamide |
| SMILES | N#Cc1ccc(OC2CCC(NC(=O)C3=C/C=C\C=C(C4CCCC4)/C=C\3)CC2)cc1Cl |
| InChI | InChI=1S/C27H29ClN2O2/c28-26-17-25(14-11-22(26)18-29)32-24-15-12-23(13-16-24)30-27(31)21-8-4-3-7-20(9-10-21)19-5-1-2-6-19/h3-4,7-11,14,17,19,23-24H,1-2,5-6,12-13,15-16H2,(H,30,31)/b4-3-,7-3-,8-4-,10-9-,20-7+,20-9+,21-8+,21-10+ |
| InChIKey | KLNSRZQLGNKHPC-PTTFFMMQSA-N |
| XLogP | 6.19 |
| TPSA | 62.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.99 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |