C20H19ClN2O2 — CID 170390702
N-[(1R,3S)-3-(3-chloro-4-cyanophenoxy)cyclopentyl]-4-methylbenzamide (PubChem CID 170390702) has the molecular formula C20H19ClN2O2 and a molecular weight of 354.84 g/mol. Its IUPAC name is N-[(1R,3S)-3-(3-chloro-4-cyanophenoxy)cyclopentyl]-4-methylbenzamide.
| Compound Name | N-[(1R,3S)-3-(3-chloro-4-cyanophenoxy)cyclopentyl]-4-methylbenzamide |
|---|---|
| PubChem CID | 170390702 |
| Molecular Formula | C20H19ClN2O2 |
| Molecular Weight | 354.84 g/mol |
| Exact Mass | 354.11 |
| IUPAC Name | N-[(1R,3S)-3-(3-chloro-4-cyanophenoxy)cyclopentyl]-4-methylbenzamide |
| SMILES | Cc1ccc(C(=O)N[C@@H]2CC[C@H](Oc3ccc(C#N)c(Cl)c3)C2)cc1 |
| InChI | InChI=1S/C20H19ClN2O2/c1-13-2-4-14(5-3-13)20(24)23-16-7-9-17(10-16)25-18-8-6-15(12-22)19(21)11-18/h2-6,8,11,16-17H,7,9-10H2,1H3,(H,23,24)/t16-,17+/m1/s1 |
| InChIKey | SIFCECPNANZZRA-SJORKVTESA-N |
| XLogP | 4.25 |
| TPSA | 62.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.84 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |