C16H18ClN5O2 — CID 155218757
2-amino-N-[4-(3-chloro-4-cyanophenoxy)cyclohexyl]-2-methanimidoyliminoacetamide (PubChem CID 155218757) has the molecular formula C16H18ClN5O2 and a molecular weight of 347.81 g/mol. Its IUPAC name is 2-amino-N-[4-(3-chloro-4-cyanophenoxy)cyclohexyl]-2-methanimidoyliminoacetamide.
| Compound Name | 2-amino-N-[4-(3-chloro-4-cyanophenoxy)cyclohexyl]-2-methanimidoyliminoacetamide |
|---|---|
| PubChem CID | 155218757 |
| Molecular Formula | C16H18ClN5O2 |
| Molecular Weight | 347.81 g/mol |
| Exact Mass | 347.11 |
| IUPAC Name | 2-amino-N-[4-(3-chloro-4-cyanophenoxy)cyclohexyl]-2-methanimidoyliminoacetamide |
| SMILES | [H]/N=C/N=C(\N)C(=O)NC1CCC(Oc2ccc(C#N)c(Cl)c2)CC1 |
| InChI | InChI=1S/C16H18ClN5O2/c17-14-7-13(4-1-10(14)8-18)24-12-5-2-11(3-6-12)22-16(23)15(20)21-9-19/h1,4,7,9,11-12H,2-3,5-6H2,(H,22,23)(H3,19,20,21) |
| InChIKey | HCDDGLMSJXKWBR-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 124.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.81 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|