C18H18Cl2N4O2 — CID 171071519
6-chloro-N-[4-(3-chloro-4-cyanophenoxy)cyclohexyl]-3,4-dihydropyridazine-3-carboxamide (PubChem CID 171071519) has the molecular formula C18H18Cl2N4O2 and a molecular weight of 393.27 g/mol. Its IUPAC name is 6-chloro-N-[4-(3-chloro-4-cyanophenoxy)cyclohexyl]-3,4-dihydropyridazine-3-carboxamide.
| Compound Name | 6-chloro-N-[4-(3-chloro-4-cyanophenoxy)cyclohexyl]-3,4-dihydropyridazine-3-carboxamide |
|---|---|
| PubChem CID | 171071519 |
| Molecular Formula | C18H18Cl2N4O2 |
| Molecular Weight | 393.27 g/mol |
| Exact Mass | 392.08 |
| IUPAC Name | 6-chloro-N-[4-(3-chloro-4-cyanophenoxy)cyclohexyl]-3,4-dihydropyridazine-3-carboxamide |
| SMILES | N#Cc1ccc(OC2CCC(NC(=O)C3CC=C(Cl)N=N3)CC2)cc1Cl |
| InChI | InChI=1S/C18H18Cl2N4O2/c19-15-9-14(4-1-11(15)10-21)26-13-5-2-12(3-6-13)22-18(25)16-7-8-17(20)24-23-16/h1,4,8-9,12-13,16H,2-3,5-7H2,(H,22,25) |
| InChIKey | VNPYKARVNRTEJI-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 86.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.27 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|