C21H21ClN2O2 — CID 170513897
N-[(1S,3S)-3-(3-chloro-4-isocyanophenoxy)-2,2-dimethylcyclobutyl]-4-methylbenzamide (PubChem CID 170513897) has the molecular formula C21H21ClN2O2 and a molecular weight of 368.86 g/mol. Its IUPAC name is N-[(1S,3S)-3-(3-chloro-4-isocyanophenoxy)-2,2-dimethylcyclobutyl]-4-methylbenzamide.
| Compound Name | N-[(1S,3S)-3-(3-chloro-4-isocyanophenoxy)-2,2-dimethylcyclobutyl]-4-methylbenzamide |
|---|---|
| PubChem CID | 170513897 |
| Molecular Formula | C21H21ClN2O2 |
| Molecular Weight | 368.86 g/mol |
| Exact Mass | 368.13 |
| IUPAC Name | N-[(1S,3S)-3-(3-chloro-4-isocyanophenoxy)-2,2-dimethylcyclobutyl]-4-methylbenzamide |
| SMILES | [C-]#[N+]c1ccc(O[C@H]2C[C@H](NC(=O)c3ccc(C)cc3)C2(C)C)cc1Cl |
| InChI | InChI=1S/C21H21ClN2O2/c1-13-5-7-14(8-6-13)20(25)24-18-12-19(21(18,2)3)26-15-9-10-17(23-4)16(22)11-15/h5-11,18-19H,12H2,1-3H3,(H,24,25)/t18-,19-/m0/s1 |
| InChIKey | PVJBGJFTTPRIND-OALUTQOASA-N |
| XLogP | 5.18 |
| TPSA | 42.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.86 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|