C16H21ClN2O — CID 153454047
3-(3-chloro-4-isocyanophenoxy)-2,2-dimethyl-N-propan-2-ylcyclobutan-1-amine (PubChem CID 153454047) has the molecular formula C16H21ClN2O and a molecular weight of 292.81 g/mol. Its IUPAC name is 3-(3-chloro-4-isocyanophenoxy)-2,2-dimethyl-N-propan-2-ylcyclobutan-1-amine.
| Compound Name | 3-(3-chloro-4-isocyanophenoxy)-2,2-dimethyl-N-propan-2-ylcyclobutan-1-amine |
|---|---|
| PubChem CID | 153454047 |
| Molecular Formula | C16H21ClN2O |
| Molecular Weight | 292.81 g/mol |
| Exact Mass | 292.13 |
| IUPAC Name | 3-(3-chloro-4-isocyanophenoxy)-2,2-dimethyl-N-propan-2-ylcyclobutan-1-amine |
| SMILES | [C-]#[N+]c1ccc(OC2CC(NC(C)C)C2(C)C)cc1Cl |
| InChI | InChI=1S/C16H21ClN2O/c1-10(2)19-14-9-15(16(14,3)4)20-11-6-7-13(18-5)12(17)8-11/h6-8,10,14-15,19H,9H2,1-4H3 |
| InChIKey | IRFOKXXJHKNJKG-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 25.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.81 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|