C21H20Cl2N4O2 — CID 167417560
3-chloro-6-[3-(3-chloro-4-isocyanophenoxy)-2,2,4,4-tetramethylcyclobutyl]-5H-pyrrolo[3,4-b]pyrazin-7-one (PubChem CID 167417560) has the molecular formula C21H20Cl2N4O2 and a molecular weight of 431.32 g/mol. Its IUPAC name is 3-chloro-6-[3-(3-chloro-4-isocyanophenoxy)-2,2,4,4-tetramethylcyclobutyl]-5H-pyrrolo[3,4-b]pyrazin-7-one.
| Compound Name | 3-chloro-6-[3-(3-chloro-4-isocyanophenoxy)-2,2,4,4-tetramethylcyclobutyl]-5H-pyrrolo[3,4-b]pyrazin-7-one |
|---|---|
| PubChem CID | 167417560 |
| Molecular Formula | C21H20Cl2N4O2 |
| Molecular Weight | 431.32 g/mol |
| Exact Mass | 430.10 |
| IUPAC Name | 3-chloro-6-[3-(3-chloro-4-isocyanophenoxy)-2,2,4,4-tetramethylcyclobutyl]-5H-pyrrolo[3,4-b]pyrazin-7-one |
| SMILES | [C-]#[N+]c1ccc(OC2C(C)(C)C(N3Cc4nc(Cl)cnc4C3=O)C2(C)C)cc1Cl |
| InChI | InChI=1S/C21H20Cl2N4O2/c1-20(2)18(27-10-14-16(17(27)28)25-9-15(23)26-14)21(3,4)19(20)29-11-6-7-13(24-5)12(22)8-11/h6-9,18-19H,10H2,1-4H3 |
| InChIKey | GYAVWWWUXOBPPM-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 59.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.32 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|